C16H20P2S — CID 89244847
2,3-bis[(2R)-2,5-ditritiophospholan-1-yl]-1-benzothiophene (PubChem CID 89244847) has the molecular formula C16H20P2S and a molecular weight of 314.38 g/mol. Its IUPAC name is 2,3-bis[(2R)-2,5-ditritiophospholan-1-yl]-1-benzothiophene.
| Compound Name | 2,3-bis[(2R)-2,5-ditritiophospholan-1-yl]-1-benzothiophene |
|---|---|
| PubChem CID | 89244847 |
| Molecular Formula | C16H20P2S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2,3-bis[(2R)-2,5-ditritiophospholan-1-yl]-1-benzothiophene |
| SMILES | [3H]C1CC[C@@H]([3H])P1c1sc2ccccc2c1P1C([3H])CC[C@H]1[3H] |
| InChI | InChI=1S/C16H20P2S/c1-2-8-14-13(7-1)15(17-9-3-4-10-17)16(19-14)18-11-5-6-12-18/h1-2,7-8H,3-6,9-12H2/i9T,10T,11T,12T/t9-,10?,11-,12?,17?,18?/m1/s1 |
| InChIKey | OGXQDEWHIRTPAX-XLUYVKAKSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|