About 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile
4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile (PubChem CID 89244997) has the molecular formula C8H12N3+
and a molecular weight of 150.20 g/mol. Its IUPAC name is 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile.
Molecular Properties
| Compound Name | 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile |
| PubChem CID | 89244997 |
| Molecular Formula | C8H12N3+ |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile |
| SMILES | CN(C)C1C=C[N+](C#N)=CC1 |
| InChI | InChI=1S/C8H12N3/c1-10(2)8-3-5-11(7-9)6-4-8/h3,5-6,8H,4H2,1-2H3/q+1 |
| InChIKey | NDNMXHCHPYYBFS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 30.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile?
The IUPAC name of 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile (CID 89244997) is 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile.
What is the SMILES notation for 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile?
The canonical SMILES for 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile is CN(C)C1C=C[N+](C#N)=CC1.
What is the InChIKey of 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile?
The InChIKey is NDNMXHCHPYYBFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N3/c1-10(2)8-3-5-11(7-9)6-4-8/h3,5-6,8H,4H2,1-2H3/q+1.
What are the key properties of 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile?
4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile has a molecular weight of 150.20 g/mol, XLogP of 0.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-3,4-dihydropyridin-1-ium-1-carbonitrile is sourced from PubChem (CID 89244997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).