About 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine
1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine (PubChem CID 89245170) has the molecular formula C15H22FN3
and a molecular weight of 263.36 g/mol. Its IUPAC name is 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine |
| PubChem CID | 89245170 |
| Molecular Formula | C15H22FN3 |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine |
| SMILES | CC1N=CC=C/C1=C(F)/C=C\CN1CCC(N)CC1 |
| InChI | InChI=1S/C15H22FN3/c1-12-14(4-2-8-18-12)15(16)5-3-9-19-10-6-13(17)7-11-19/h2-5,8,12-13H,6-7,9-11,17H2,1H3/b5-3-,15-14+ |
| InChIKey | XEGXPFPZXKGGLY-JODZDXIWSA-N |
| XLogP | 2.22 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine?
The IUPAC name of 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine (CID 89245170) is 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine.
What is the SMILES notation for 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine?
The canonical SMILES for 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine is CC1N=CC=C/C1=C(F)/C=C\CN1CCC(N)CC1.
What is the InChIKey of 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine?
The InChIKey is XEGXPFPZXKGGLY-JODZDXIWSA-N. The full InChI is InChI=1S/C15H22FN3/c1-12-14(4-2-8-18-12)15(16)5-3-9-19-10-6-13(17)7-11-19/h2-5,8,12-13H,6-7,9-11,17H2,1H3/b5-3-,15-14+.
What are the key properties of 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine?
1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine has a molecular weight of 263.36 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z,4E)-4-fluoro-4-(2-methyl-2H-pyridin-3-ylidene)but-2-enyl]piperidin-4-amine is sourced from PubChem (CID 89245170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).