About N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine
N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 89245377) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 89245377 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | C1=CCC(NCC2C=NC=CC2)C=C1 |
| InChI | InChI=1S/C12H16N2/c1-2-6-12(7-3-1)14-10-11-5-4-8-13-9-11/h1-4,6,8-9,11-12,14H,5,7,10H2 |
| InChIKey | URNMBHLAMMVPJF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine (CID 89245377) is N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine is C1=CCC(NCC2C=NC=CC2)C=C1.
What is the InChIKey of N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine?
The InChIKey is URNMBHLAMMVPJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-2-6-12(7-3-1)14-10-11-5-4-8-13-9-11/h1-4,6,8-9,11-12,14H,5,7,10H2.
What are the key properties of N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine?
N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine has a molecular weight of 188.27 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydropyridin-3-ylmethyl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 89245377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).