C10H18N2 — CID 89245508
(1Z,3E)-N,N-dimethyl-2-(methylideneamino)hepta-1,3-dien-1-amine (PubChem CID 89245508) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (1Z,3E)-N,N-dimethyl-2-(methylideneamino)hepta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-N,N-dimethyl-2-(methylideneamino)hepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 89245508 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (1Z,3E)-N,N-dimethyl-2-(methylideneamino)hepta-1,3-dien-1-amine |
| SMILES | C=NC(=C\N(C)C)/C=C/CCC |
| InChI | InChI=1S/C10H18N2/c1-5-6-7-8-10(11-2)9-12(3)4/h7-9H,2,5-6H2,1,3-4H3/b8-7+,10-9- |
| InChIKey | VBDZJPCSGAFURZ-GOJKSUSPSA-N |
| XLogP | 2.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|