C12H17NO2 — CID 89245510
N-[(2S,3E,5Z,7Z)-nona-3,5,7-trien-2-yl]-2-oxopropanamide (PubChem CID 89245510) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-[(2S,3E,5Z,7Z)-nona-3,5,7-trien-2-yl]-2-oxopropanamide.
| Compound Name | N-[(2S,3E,5Z,7Z)-nona-3,5,7-trien-2-yl]-2-oxopropanamide |
|---|---|
| PubChem CID | 89245510 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-[(2S,3E,5Z,7Z)-nona-3,5,7-trien-2-yl]-2-oxopropanamide |
| SMILES | C/C=C\C=C/C=C/[C@H](C)NC(=O)C(C)=O |
| InChI | InChI=1S/C12H17NO2/c1-4-5-6-7-8-9-10(2)13-12(15)11(3)14/h4-10H,1-3H3,(H,13,15)/b5-4-,7-6-,9-8+/t10-/m0/s1 |
| InChIKey | HROVCXKDEWTPBR-VPPPAHRTSA-N |
| XLogP | 1.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|