C28H39FO5S — CID 89245553
(2R,4S,6R,7R,9R,14S)-4-[2-(benzenesulfinyl)-2-fluoroethyl]-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one (PubChem CID 89245553) has the molecular formula C28H39FO5S and a molecular weight of 506.68 g/mol. Its IUPAC name is (2R,4S,6R,7R,9R,14S)-4-[2-(benzenesulfinyl)-2-fluoroethyl]-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one.
| Compound Name | (2R,4S,6R,7R,9R,14S)-4-[2-(benzenesulfinyl)-2-fluoroethyl]-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one |
|---|---|
| PubChem CID | 89245553 |
| Molecular Formula | C28H39FO5S |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | (2R,4S,6R,7R,9R,14S)-4-[2-(benzenesulfinyl)-2-fluoroethyl]-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one |
| SMILES | COCO[C@@H]1C[C@@](C)(CC(F)S(=O)c2ccccc2)C(=O)[C@H](C)C23CCC(OC)C2[C@]12C[C@@H]2CC3 |
| InChI | InChI=1S/C28H39FO5S/c1-18-25(30)26(2,16-23(29)35(31)20-8-6-5-7-9-20)15-22(34-17-32-3)28-14-19(28)10-12-27(18)13-11-21(33-4)24(27)28/h5-9,18-19,21-24H,10-17H2,1-4H3/t18-,19-,21?,22+,23?,24?,26-,27?,28-,35?/m0/s1 |
| InChIKey | CUPVMXZLFYJPMQ-RJWXNTSMSA-N |
| XLogP | 5.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|