C25H40O6 — CID 89245588
(2R,3S,4S,6R,7R,14R)-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyl-4-[(E)-2-(4-methyl-1,3-dioxetan-2-yl)ethenyl]tricyclo[5.4.3.01,8]tetradecan-9-one (PubChem CID 89245588) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is (2R,3S,4S,6R,7R,14R)-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyl-4-[(E)-2-(4-methyl-1,3-dioxetan-2-yl)ethenyl]tricyclo[5.4.3.01,8]tetradecan-9-one.
| Compound Name | (2R,3S,4S,6R,7R,14R)-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyl-4-[(E)-2-(4-methyl-1,3-dioxetan-2-yl)ethenyl]tricyclo[5.4.3.01,8]tetradecan-9-one |
|---|---|
| PubChem CID | 89245588 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (2R,3S,4S,6R,7R,14R)-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyl-4-[(E)-2-(4-methyl-1,3-dioxetan-2-yl)ethenyl]tricyclo[5.4.3.01,8]tetradecan-9-one |
| SMILES | COCO[C@H]1[C@H](C)C23CCC(=O)C2[C@@](C)([C@H](C)CC3)[C@H](O)C[C@@]1(C)/C=C/C1OC(C)O1 |
| InChI | InChI=1S/C25H40O6/c1-15-7-11-25-12-8-18(26)21(25)24(15,5)19(27)13-23(4,10-9-20-30-17(3)31-20)22(16(25)2)29-14-28-6/h9-10,15-17,19-22,27H,7-8,11-14H2,1-6H3/b10-9+/t15-,16+,17?,19-,20?,21?,22+,23-,24+,25?/m1/s1 |
| InChIKey | NEPJDZAHHPISSS-XQZYQVNSSA-N |
| XLogP | 4.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|