C22H34O3 — CID 89245598
(2R,4R,6R,7R,9R,14S)-6-hydroxy-9-methoxy-2,4-dimethyl-4-(2-methylprop-2-enyl)tetracyclo[5.4.4.01,8.07,14]pentadecan-3-one (PubChem CID 89245598) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (2R,4R,6R,7R,9R,14S)-6-hydroxy-9-methoxy-2,4-dimethyl-4-(2-methylprop-2-enyl)tetracyclo[5.4.4.01,8.07,14]pentadecan-3-one.
| Compound Name | (2R,4R,6R,7R,9R,14S)-6-hydroxy-9-methoxy-2,4-dimethyl-4-(2-methylprop-2-enyl)tetracyclo[5.4.4.01,8.07,14]pentadecan-3-one |
|---|---|
| PubChem CID | 89245598 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (2R,4R,6R,7R,9R,14S)-6-hydroxy-9-methoxy-2,4-dimethyl-4-(2-methylprop-2-enyl)tetracyclo[5.4.4.01,8.07,14]pentadecan-3-one |
| SMILES | C=C(C)C[C@]1(C)C[C@@H](O)[C@]23C[C@@H]2CCC2(CCC(OC)C23)[C@@H](C)C1=O |
| InChI | InChI=1S/C22H34O3/c1-13(2)10-20(4)12-17(23)22-11-15(22)6-8-21(14(3)19(20)24)9-7-16(25-5)18(21)22/h14-18,23H,1,6-12H2,2-5H3/t14-,15-,16?,17+,18?,20+,21?,22-/m0/s1 |
| InChIKey | YQKDTCRNWBGTEK-OOWONVNWSA-N |
| XLogP | 4.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|