C21H33FO4 — CID 89245639
(2R,4R,6R,7R,9R,14S)-4-(fluoromethyl)-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one (PubChem CID 89245639) has the molecular formula C21H33FO4 and a molecular weight of 368.49 g/mol. Its IUPAC name is (2R,4R,6R,7R,9R,14S)-4-(fluoromethyl)-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one.
| Compound Name | (2R,4R,6R,7R,9R,14S)-4-(fluoromethyl)-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one |
|---|---|
| PubChem CID | 89245639 |
| Molecular Formula | C21H33FO4 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (2R,4R,6R,7R,9R,14S)-4-(fluoromethyl)-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one |
| SMILES | COCO[C@@H]1C[C@@](C)(CF)C(=O)[C@H](C)C23CCC(OC)C2[C@]12C[C@@H]2CC3 |
| InChI | InChI=1S/C21H33FO4/c1-13-18(23)19(2,11-22)10-16(26-12-24-3)21-9-14(21)5-7-20(13)8-6-15(25-4)17(20)21/h13-17H,5-12H2,1-4H3/t13-,14-,15?,16+,17?,19-,20?,21-/m0/s1 |
| InChIKey | IPDFNGBWVJWRNA-SFEFLWEGSA-N |
| XLogP | 3.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|