C23H37FO4 — CID 89245642
(2R,4R,6R,7R,9R,14S)-4-(3-fluoropropyl)-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one (PubChem CID 89245642) has the molecular formula C23H37FO4 and a molecular weight of 396.54 g/mol. Its IUPAC name is (2R,4R,6R,7R,9R,14S)-4-(3-fluoropropyl)-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one.
| Compound Name | (2R,4R,6R,7R,9R,14S)-4-(3-fluoropropyl)-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one |
|---|---|
| PubChem CID | 89245642 |
| Molecular Formula | C23H37FO4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (2R,4R,6R,7R,9R,14S)-4-(3-fluoropropyl)-9-methoxy-6-(methoxymethoxy)-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one |
| SMILES | COCO[C@@H]1C[C@@](C)(CCCF)C(=O)[C@H](C)C23CCC(OC)C2[C@]12C[C@@H]2CC3 |
| InChI | InChI=1S/C23H37FO4/c1-15-20(25)21(2,8-5-11-24)13-18(28-14-26-3)23-12-16(23)6-9-22(15)10-7-17(27-4)19(22)23/h15-19H,5-14H2,1-4H3/t15-,16-,17?,18+,19?,21+,22?,23-/m0/s1 |
| InChIKey | UECNQCSRZJJCOY-BUMAEXNGSA-N |
| XLogP | 4.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|