C19H35N — CID 89245683
(4E,6Z)-N-tert-butyl-N,2,2,4,5,7-hexamethylnona-4,6,8-trien-3-amine (PubChem CID 89245683) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is (4E,6Z)-N-tert-butyl-N,2,2,4,5,7-hexamethylnona-4,6,8-trien-3-amine.
| Compound Name | (4E,6Z)-N-tert-butyl-N,2,2,4,5,7-hexamethylnona-4,6,8-trien-3-amine |
|---|---|
| PubChem CID | 89245683 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | (4E,6Z)-N-tert-butyl-N,2,2,4,5,7-hexamethylnona-4,6,8-trien-3-amine |
| SMILES | C=C/C(C)=C\C(C)=C(/C)C(N(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H35N/c1-12-14(2)13-15(3)16(4)17(18(5,6)7)20(11)19(8,9)10/h12-13,17H,1H2,2-11H3/b14-13-,16-15+ |
| InChIKey | AIMPSIVBRRUEJR-DHEZTBRESA-N |
| XLogP | 5.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|