C10H13NO2 — CID 89245768
(2R)-2,6-dimethyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one (PubChem CID 89245768) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (2R)-2,6-dimethyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one.
| Compound Name | (2R)-2,6-dimethyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 89245768 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2R)-2,6-dimethyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one |
| SMILES | CC1=CC2NC(=O)[C@@H](C)OC2C=C1 |
| InChI | InChI=1S/C10H13NO2/c1-6-3-4-9-8(5-6)11-10(12)7(2)13-9/h3-5,7-9H,1-2H3,(H,11,12)/t7-,8?,9?/m1/s1 |
| InChIKey | ZSWVYUWWMLPNCU-AFPNSQJFSA-N |
| XLogP | 0.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |