C32H36N2O5 — CID 89245861
2-[(1S,5R,6S,9R,10R)-13-butoxy-4-(cyclopropylmethyl)-6-hydroxy-16-methyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-yl]isoindole-1,3-dione (PubChem CID 89245861) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is 2-[(1S,5R,6S,9R,10R)-13-butoxy-4-(cyclopropylmethyl)-6-hydroxy-16-methyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1S,5R,6S,9R,10R)-13-butoxy-4-(cyclopropylmethyl)-6-hydroxy-16-methyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 89245861 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 2-[(1S,5R,6S,9R,10R)-13-butoxy-4-(cyclopropylmethyl)-6-hydroxy-16-methyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-yl]isoindole-1,3-dione |
| SMILES | CCCCOc1ccc(C)c2c1O[C@H]1[C@H](N3C(=O)c4ccccc4C3=O)CC[C@@]3(O)[C@H]4C(C[C@]213)N4CC1CC1 |
| InChI | InChI=1S/C32H36N2O5/c1-3-4-15-38-24-12-9-18(2)25-26(24)39-28-22(34-29(35)20-7-5-6-8-21(20)30(34)36)13-14-32(37)27-23(16-31(25,28)32)33(27)17-19-10-11-19/h5-9,12,19,22-23,27-28,37H,3-4,10-11,13-17H2,1-2H3/t22-,23?,27-,28+,31+,32-,33?/m1/s1 |
| InChIKey | KCUVCEWLKRZEPQ-QXCXUKCZSA-N |
| XLogP | 4.23 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|