C10H15ClN2O2S — CID 89245904
N-[4-[1-(chloroamino)ethyl]-2-methylphenyl]methanesulfonamide (PubChem CID 89245904) has the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. Its IUPAC name is N-[4-[1-(chloroamino)ethyl]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[4-[1-(chloroamino)ethyl]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 89245904 |
| Molecular Formula | C10H15ClN2O2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | N-[4-[1-(chloroamino)ethyl]-2-methylphenyl]methanesulfonamide |
| SMILES | Cc1cc(C(C)NCl)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C10H15ClN2O2S/c1-7-6-9(8(2)12-11)4-5-10(7)13-16(3,14)15/h4-6,8,12-13H,1-3H3 |
| InChIKey | DLPCWRMWWBGIIY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|