C9H18N2 — CID 89245909
(4aS,7aS)-4a,6-dimethyl-2,3,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine (PubChem CID 89245909) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (4aS,7aS)-4a,6-dimethyl-2,3,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-4a,6-dimethyl-2,3,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 89245909 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (4aS,7aS)-4a,6-dimethyl-2,3,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine |
| SMILES | CN1C[C@H]2NCCC[C@@]2(C)C1 |
| InChI | InChI=1S/C9H18N2/c1-9-4-3-5-10-8(9)6-11(2)7-9/h8,10H,3-7H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | PTSCGRYPFDKDCX-BDAKNGLRSA-N |
| XLogP | 0.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |