C16H32Cl3N — CID 89245991
8,11-dichloro-5-(1-chloroethyl)-2,6,9-trimethylundecan-3-amine (PubChem CID 89245991) has the molecular formula C16H32Cl3N and a molecular weight of 344.80 g/mol. Its IUPAC name is 8,11-dichloro-5-(1-chloroethyl)-2,6,9-trimethylundecan-3-amine.
| Compound Name | 8,11-dichloro-5-(1-chloroethyl)-2,6,9-trimethylundecan-3-amine |
|---|---|
| PubChem CID | 89245991 |
| Molecular Formula | C16H32Cl3N |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 8,11-dichloro-5-(1-chloroethyl)-2,6,9-trimethylundecan-3-amine |
| SMILES | CC(C)C(N)CC(C(C)Cl)C(C)CC(Cl)C(C)CCCl |
| InChI | InChI=1S/C16H32Cl3N/c1-10(2)16(20)9-14(13(5)18)12(4)8-15(19)11(3)6-7-17/h10-16H,6-9,20H2,1-5H3 |
| InChIKey | CRTYRUYKNNDSLL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|