C9H15I — CID 89246005
(2Z,4E)-1-iodo-2,5-dimethylhepta-2,4-diene (PubChem CID 89246005) has the molecular formula C9H15I and a molecular weight of 250.12 g/mol. Its IUPAC name is (2Z,4E)-1-iodo-2,5-dimethylhepta-2,4-diene.
| Compound Name | (2Z,4E)-1-iodo-2,5-dimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 89246005 |
| Molecular Formula | C9H15I |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | (2Z,4E)-1-iodo-2,5-dimethylhepta-2,4-diene |
| SMILES | CC/C(C)=C/C=C(/C)CI |
| InChI | InChI=1S/C9H15I/c1-4-8(2)5-6-9(3)7-10/h5-6H,4,7H2,1-3H3/b8-5+,9-6- |
| InChIKey | GZKQCCFHLBEYES-OWNHSFIXSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|