C12H16N2O3 — CID 89246142
(3-amino-2-hydroxyphenyl)-[(3S)-3-hydroxypiperidin-1-yl]methanone (PubChem CID 89246142) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is (3-amino-2-hydroxyphenyl)-[(3S)-3-hydroxypiperidin-1-yl]methanone.
| Compound Name | (3-amino-2-hydroxyphenyl)-[(3S)-3-hydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 89246142 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (3-amino-2-hydroxyphenyl)-[(3S)-3-hydroxypiperidin-1-yl]methanone |
| SMILES | Nc1cccc(C(=O)N2CCC[C@H](O)C2)c1O |
| InChI | InChI=1S/C12H16N2O3/c13-10-5-1-4-9(11(10)16)12(17)14-6-2-3-8(15)7-14/h1,4-5,8,15-16H,2-3,6-7,13H2/t8-/m0/s1 |
| InChIKey | GWPDVRVZKIDZOE-QMMMGPOBSA-N |
| XLogP | 0.57 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|