About cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine
cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine (PubChem CID 89246169) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine.
Molecular Properties
| Compound Name | cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine |
| PubChem CID | 89246169 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine |
| SMILES | NC(C1CC1)C1CC=CS1 |
| InChI | InChI=1S/C8H13NS/c9-8(6-3-4-6)7-2-1-5-10-7/h1,5-8H,2-4,9H2 |
| InChIKey | RZRIKXFPFFLJOR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine?
The IUPAC name of cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine (CID 89246169) is cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine.
What is the SMILES notation for cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine?
The canonical SMILES for cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine is NC(C1CC1)C1CC=CS1.
What is the InChIKey of cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine?
The InChIKey is RZRIKXFPFFLJOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c9-8(6-3-4-6)7-2-1-5-10-7/h1,5-8H,2-4,9H2.
What are the key properties of cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine?
cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine has a molecular weight of 155.27 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl(2,3-dihydrothiophen-2-yl)methanamine is sourced from PubChem (CID 89246169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).