C27H45N7O4S3 — CID 89246214
N-aminosulfanyl-2-[[(1R)-2,2-dimethyl-1-[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]propyl]amino]-N'-[5-(ethylsulfamoyl)-4-hydroxythiophen-3-yl]prop-2-enimidamide (PubChem CID 89246214) has the molecular formula C27H45N7O4S3 and a molecular weight of 627.90 g/mol. Its IUPAC name is N-aminosulfanyl-2-[[(1R)-2,2-dimethyl-1-[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]propyl]amino]-N'-[5-(ethylsulfamoyl)-4-hydroxythiophen-3-yl]prop-2-enimidamide.
| Compound Name | N-aminosulfanyl-2-[[(1R)-2,2-dimethyl-1-[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]propyl]amino]-N'-[5-(ethylsulfamoyl)-4-hydroxythiophen-3-yl]prop-2-enimidamide |
|---|---|
| PubChem CID | 89246214 |
| Molecular Formula | C27H45N7O4S3 |
| Molecular Weight | 627.90 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | N-aminosulfanyl-2-[[(1R)-2,2-dimethyl-1-[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]propyl]amino]-N'-[5-(ethylsulfamoyl)-4-hydroxythiophen-3-yl]prop-2-enimidamide |
| SMILES | C=C(N[C@@H](c1cc(CCCCN2CCN(C)CC2)co1)C(C)(C)C)/C(=N/c1csc(S(=O)(=O)NCC)c1O)NSN |
| InChI | InChI=1S/C27H45N7O4S3/c1-7-29-41(36,37)26-23(35)21(18-39-26)31-25(32-40-28)19(2)30-24(27(3,4)5)22-16-20(17-38-22)10-8-9-11-34-14-12-33(6)13-15-34/h16-18,24,29-30,35H,2,7-15,28H2,1,3-6H3,(H,31,32)/t24-/m0/s1 |
| InChIKey | YDNDZQFZBGIJCG-DEOSSOPVSA-N |
| XLogP | 3.95 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|