C13H25NO2 — CID 89246284
(2E,4Z)-3-[1-(propan-2-ylamino)propan-2-yl]hepta-2,4-diene-1,6-diol (PubChem CID 89246284) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is (2E,4Z)-3-[1-(propan-2-ylamino)propan-2-yl]hepta-2,4-diene-1,6-diol.
| Compound Name | (2E,4Z)-3-[1-(propan-2-ylamino)propan-2-yl]hepta-2,4-diene-1,6-diol |
|---|---|
| PubChem CID | 89246284 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | (2E,4Z)-3-[1-(propan-2-ylamino)propan-2-yl]hepta-2,4-diene-1,6-diol |
| SMILES | CC(O)/C=C\C(=C/CO)C(C)CNC(C)C |
| InChI | InChI=1S/C13H25NO2/c1-10(2)14-9-11(3)13(7-8-15)6-5-12(4)16/h5-7,10-12,14-16H,8-9H2,1-4H3/b6-5-,13-7+ |
| InChIKey | CUFYJNCTEUCKMJ-RKOYKYSNSA-N |
| XLogP | 1.48 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|