C17H25N5O4S3 — CID 89246290
2-N'-[5-(dimethylsulfamoyl)-4-hydroxythiophen-3-yl]-1-N'-[(1R)-1-(5-methylfuran-2-yl)propyl]-2-N-methylsulfanylethanediimidamide (PubChem CID 89246290) has the molecular formula C17H25N5O4S3 and a molecular weight of 459.62 g/mol. Its IUPAC name is 2-N'-[5-(dimethylsulfamoyl)-4-hydroxythiophen-3-yl]-1-N'-[(1R)-1-(5-methylfuran-2-yl)propyl]-2-N-methylsulfanylethanediimidamide.
| Compound Name | 2-N'-[5-(dimethylsulfamoyl)-4-hydroxythiophen-3-yl]-1-N'-[(1R)-1-(5-methylfuran-2-yl)propyl]-2-N-methylsulfanylethanediimidamide |
|---|---|
| PubChem CID | 89246290 |
| Molecular Formula | C17H25N5O4S3 |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 2-N'-[5-(dimethylsulfamoyl)-4-hydroxythiophen-3-yl]-1-N'-[(1R)-1-(5-methylfuran-2-yl)propyl]-2-N-methylsulfanylethanediimidamide |
| SMILES | CC[C@@H](/N=C(N)/C(=N/c1csc(S(=O)(=O)N(C)C)c1O)NSC)c1ccc(C)o1 |
| InChI | InChI=1S/C17H25N5O4S3/c1-6-11(13-8-7-10(2)26-13)19-15(18)16(21-27-5)20-12-9-28-17(14(12)23)29(24,25)22(3)4/h7-9,11,23H,6H2,1-5H3,(H2,18,19)(H,20,21)/t11-/m1/s1 |
| InChIKey | BZWKLONMDYAIIA-LLVKDONJSA-N |
| XLogP | 3.01 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|