C19H29N5O3S4 — CID 89246381
N-aminosulfanyl-2-[[(1R)-1-(4,5-dimethylthiophen-2-yl)-2-methylpropyl]amino]-N'-[5-(ethylsulfamoyl)-4-hydroxythiophen-3-yl]prop-2-enimidamide (PubChem CID 89246381) has the molecular formula C19H29N5O3S4 and a molecular weight of 503.74 g/mol. Its IUPAC name is N-aminosulfanyl-2-[[(1R)-1-(4,5-dimethylthiophen-2-yl)-2-methylpropyl]amino]-N'-[5-(ethylsulfamoyl)-4-hydroxythiophen-3-yl]prop-2-enimidamide.
| Compound Name | N-aminosulfanyl-2-[[(1R)-1-(4,5-dimethylthiophen-2-yl)-2-methylpropyl]amino]-N'-[5-(ethylsulfamoyl)-4-hydroxythiophen-3-yl]prop-2-enimidamide |
|---|---|
| PubChem CID | 89246381 |
| Molecular Formula | C19H29N5O3S4 |
| Molecular Weight | 503.74 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | N-aminosulfanyl-2-[[(1R)-1-(4,5-dimethylthiophen-2-yl)-2-methylpropyl]amino]-N'-[5-(ethylsulfamoyl)-4-hydroxythiophen-3-yl]prop-2-enimidamide |
| SMILES | C=C(N[C@@H](c1cc(C)c(C)s1)C(C)C)/C(=N/c1csc(S(=O)(=O)NCC)c1O)NSN |
| InChI | InChI=1S/C19H29N5O3S4/c1-7-21-31(26,27)19-17(25)14(9-28-19)23-18(24-30-20)12(5)22-16(10(2)3)15-8-11(4)13(6)29-15/h8-10,16,21-22,25H,5,7,20H2,1-4,6H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | GFIJQRDTAOWPBG-MRXNPFEDSA-N |
| XLogP | 4.07 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|