C23H32O5 — CID 89246449
(2R,4S,6S,10R,16R)-4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),8-diene-13,16-diol (PubChem CID 89246449) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is (2R,4S,6S,10R,16R)-4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),8-diene-13,16-diol.
| Compound Name | (2R,4S,6S,10R,16R)-4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),8-diene-13,16-diol |
|---|---|
| PubChem CID | 89246449 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (2R,4S,6S,10R,16R)-4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),8-diene-13,16-diol |
| SMILES | C=C[C@@H]1O[C@@H]2C3=C(C)CC[C@@](O)(CC4C(C)(C=C[C@H]5OCC45O)[C@@H]2O1)C3(C)C |
| InChI | InChI=1S/C23H32O5/c1-6-16-27-18-17-13(2)7-10-22(24,20(17,3)4)11-14-21(5,19(18)28-16)9-8-15-23(14,25)12-26-15/h6,8-9,14-16,18-19,24-25H,1,7,10-12H2,2-5H3/t14?,15-,16-,18-,19-,21?,22-,23?/m1/s1 |
| InChIKey | PEJGJONANBXDCM-ZRYDUNRGSA-N |
| XLogP | 2.88 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|