C22H31N5O2S — CID 89246469
(7-azido-3,4-dihydro-1H-isoquinolin-2-yl)-[(1R,3R)-1-(methylsulfanylmethyl)-3-(oxan-4-ylamino)cyclopentyl]methanone (PubChem CID 89246469) has the molecular formula C22H31N5O2S and a molecular weight of 429.59 g/mol. Its IUPAC name is (7-azido-3,4-dihydro-1H-isoquinolin-2-yl)-[(1R,3R)-1-(methylsulfanylmethyl)-3-(oxan-4-ylamino)cyclopentyl]methanone.
| Compound Name | (7-azido-3,4-dihydro-1H-isoquinolin-2-yl)-[(1R,3R)-1-(methylsulfanylmethyl)-3-(oxan-4-ylamino)cyclopentyl]methanone |
|---|---|
| PubChem CID | 89246469 |
| Molecular Formula | C22H31N5O2S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (7-azido-3,4-dihydro-1H-isoquinolin-2-yl)-[(1R,3R)-1-(methylsulfanylmethyl)-3-(oxan-4-ylamino)cyclopentyl]methanone |
| SMILES | CSC[C@]1(C(=O)N2CCc3ccc(N=[N+]=[N-])cc3C2)CC[C@@H](NC2CCOCC2)C1 |
| InChI | InChI=1S/C22H31N5O2S/c1-30-15-22(8-4-20(13-22)24-18-6-10-29-11-7-18)21(28)27-9-5-16-2-3-19(25-26-23)12-17(16)14-27/h2-3,12,18,20,24H,4-11,13-15H2,1H3/t20-,22+/m1/s1 |
| InChIKey | JIWAGRXAXMNHSA-IRLDBZIGSA-N |
| XLogP | 4.18 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|