About (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne
(3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne (PubChem CID 89246542) has the molecular formula C15H21F
and a molecular weight of 220.33 g/mol. Its IUPAC name is (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne.
Molecular Properties
| Compound Name | (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne |
| PubChem CID | 89246542 |
| Molecular Formula | C15H21F |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne |
| SMILES | C=C(C)/C(=C\C)CC#C/C(CC)=C(/F)CC |
| InChI | InChI=1S/C15H21F/c1-6-13(12(4)5)10-9-11-14(7-2)15(16)8-3/h6H,4,7-8,10H2,1-3,5H3/b13-6-,15-14+ |
| InChIKey | SFFHCYOUVMUHIR-IAWNYDFXSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne?
The IUPAC name of (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne (CID 89246542) is (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne.
What is the SMILES notation for (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne?
The canonical SMILES for (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne is C=C(C)/C(=C\C)CC#C/C(CC)=C(/F)CC.
What is the InChIKey of (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne?
The InChIKey is SFFHCYOUVMUHIR-IAWNYDFXSA-N. The full InChI is InChI=1S/C15H21F/c1-6-13(12(4)5)10-9-11-14(7-2)15(16)8-3/h6H,4,7-8,10H2,1-3,5H3/b13-6-,15-14+.
What are the key properties of (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne?
(3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne has a molecular weight of 220.33 g/mol, XLogP of 4.95, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,7E)-7-ethyl-3-ethylidene-8-fluoro-2-methyldeca-1,7-dien-5-yne is sourced from PubChem (CID 89246542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).