C29H30F3IN4O2 — CID 89246568
1-[3-[(Z)-1-hydroxy-2-(iodoamino)ethenyl]-5-methylphenyl]-6,6-dimethyl-3-[5-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]-5,7-dihydrocyclopenta[d]pyridazin-4-one (PubChem CID 89246568) has the molecular formula C29H30F3IN4O2 and a molecular weight of 650.48 g/mol. Its IUPAC name is 1-[3-[(Z)-1-hydroxy-2-(iodoamino)ethenyl]-5-methylphenyl]-6,6-dimethyl-3-[5-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]-5,7-dihydrocyclopenta[d]pyridazin-4-one.
| Compound Name | 1-[3-[(Z)-1-hydroxy-2-(iodoamino)ethenyl]-5-methylphenyl]-6,6-dimethyl-3-[5-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]-5,7-dihydrocyclopenta[d]pyridazin-4-one |
|---|---|
| PubChem CID | 89246568 |
| Molecular Formula | C29H30F3IN4O2 |
| Molecular Weight | 650.48 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | 1-[3-[(Z)-1-hydroxy-2-(iodoamino)ethenyl]-5-methylphenyl]-6,6-dimethyl-3-[5-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]-5,7-dihydrocyclopenta[d]pyridazin-4-one |
| SMILES | Cc1cc(/C(O)=C/NI)cc(-c2nn(-c3cc(N4CCCC4)ccc3C(F)(F)F)c(=O)c3c2CC(C)(C)C3)c1 |
| InChI | InChI=1S/C29H30F3IN4O2/c1-17-10-18(25(38)16-34-33)12-19(11-17)26-21-14-28(2,3)15-22(21)27(39)37(35-26)24-13-20(36-8-4-5-9-36)6-7-23(24)29(30,31)32/h6-7,10-13,16,34,38H,4-5,8-9,14-15H2,1-3H3/b25-16- |
| InChIKey | IYRRSOCZYHMINU-XYGWBWBKSA-N |
| XLogP | 6.75 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.48 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|