C9H14O — CID 89246814
(3Z,5Z)-4-methylocta-1,3,5-trien-2-ol (PubChem CID 89246814) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (3Z,5Z)-4-methylocta-1,3,5-trien-2-ol.
| Compound Name | (3Z,5Z)-4-methylocta-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 89246814 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3Z,5Z)-4-methylocta-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C(C)\C=C/CC |
| InChI | InChI=1S/C9H14O/c1-4-5-6-8(2)7-9(3)10/h5-7,10H,3-4H2,1-2H3/b6-5-,8-7- |
| InChIKey | AYLIIPJDTRPXEY-ISTTXYCBSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|