C30H36N2O2 — CID 89247148
N,N-diethyl-N'-[1-(7-methoxy-1-benzofuran-2-yl)ethenyl]-N'-(naphthalen-2-ylmethyl)butane-1,4-diamine (PubChem CID 89247148) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is N,N-diethyl-N'-[1-(7-methoxy-1-benzofuran-2-yl)ethenyl]-N'-(naphthalen-2-ylmethyl)butane-1,4-diamine.
| Compound Name | N,N-diethyl-N'-[1-(7-methoxy-1-benzofuran-2-yl)ethenyl]-N'-(naphthalen-2-ylmethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 89247148 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | N,N-diethyl-N'-[1-(7-methoxy-1-benzofuran-2-yl)ethenyl]-N'-(naphthalen-2-ylmethyl)butane-1,4-diamine |
| SMILES | C=C(c1cc2cccc(OC)c2o1)N(CCCCN(CC)CC)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H36N2O2/c1-5-31(6-2)18-9-10-19-32(22-24-16-17-25-12-7-8-13-26(25)20-24)23(3)29-21-27-14-11-15-28(33-4)30(27)34-29/h7-8,11-17,20-21H,3,5-6,9-10,18-19,22H2,1-2,4H3 |
| InChIKey | KQORHPLHXZGODV-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 28.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|