C23H26N2O5 — CID 89247321
5-[6-(dihydroxyamino)-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl]pentanoic acid (PubChem CID 89247321) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 5-[6-(dihydroxyamino)-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl]pentanoic acid.
| Compound Name | 5-[6-(dihydroxyamino)-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl]pentanoic acid |
|---|---|
| PubChem CID | 89247321 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 5-[6-(dihydroxyamino)-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl]pentanoic acid |
| SMILES | CC1(C)c2ccccc2N(CCCCC(=O)O)C12C=Cc1cc(N(O)O)ccc1O2 |
| InChI | InChI=1S/C23H26N2O5/c1-22(2)18-7-3-4-8-19(18)24(14-6-5-9-21(26)27)23(22)13-12-16-15-17(25(28)29)10-11-20(16)30-23/h3-4,7-8,10-13,15,28-29H,5-6,9,14H2,1-2H3,(H,26,27) |
| InChIKey | JXRHRQKYNVZHSM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|