About 6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene
6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene (PubChem CID 89247351) has the molecular formula C11H15FO
and a molecular weight of 182.24 g/mol. Its IUPAC name is 6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene.
Analyze 6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene?
The IUPAC name of 6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene (CID 89247351) is 6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene.
What is the SMILES notation for 6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene?
The canonical SMILES for 6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene is CC1COC2=C(C=C(F)C(C)C2)C1.
What is the InChIKey of 6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene?
The InChIKey is KHOXLNJPACTVEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FO/c1-7-3-9-5-10(12)8(2)4-11(9)13-6-7/h5,7-8H,3-4,6H2,1-2H3.
What are the key properties of 6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene?
6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene has a molecular weight of 182.24 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,7-dimethyl-3,4,7,8-tetrahydro-2H-chromene is sourced from PubChem (CID 89247351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).