About 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran
6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran (PubChem CID 89247358) has the molecular formula C12H19FO
and a molecular weight of 198.28 g/mol. Its IUPAC name is 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran |
| PubChem CID | 89247358 |
| Molecular Formula | C12H19FO |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran |
| SMILES | CCC1=C(/C=C(/F)CC)CC(C)CO1 |
| InChI | InChI=1S/C12H19FO/c1-4-11(13)7-10-6-9(3)8-14-12(10)5-2/h7,9H,4-6,8H2,1-3H3/b11-7+ |
| InChIKey | NHQKYXDKFVUJSE-YRNVUSSQSA-N |
| XLogP | 3.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran?
The IUPAC name of 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran (CID 89247358) is 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran.
What is the SMILES notation for 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran?
The canonical SMILES for 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran is CCC1=C(/C=C(/F)CC)CC(C)CO1.
What is the InChIKey of 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran?
The InChIKey is NHQKYXDKFVUJSE-YRNVUSSQSA-N. The full InChI is InChI=1S/C12H19FO/c1-4-11(13)7-10-6-9(3)8-14-12(10)5-2/h7,9H,4-6,8H2,1-3H3/b11-7+.
What are the key properties of 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran?
6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran has a molecular weight of 198.28 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-5-[(E)-2-fluorobut-1-enyl]-3-methyl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 89247358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).