C13H22F2O — CID 89247359
(2E,4Z)-4-ethoxy-5-ethyl-1,3-difluoro-2-methylocta-2,4-diene (PubChem CID 89247359) has the molecular formula C13H22F2O and a molecular weight of 232.31 g/mol. Its IUPAC name is (2E,4Z)-4-ethoxy-5-ethyl-1,3-difluoro-2-methylocta-2,4-diene.
| Compound Name | (2E,4Z)-4-ethoxy-5-ethyl-1,3-difluoro-2-methylocta-2,4-diene |
|---|---|
| PubChem CID | 89247359 |
| Molecular Formula | C13H22F2O |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (2E,4Z)-4-ethoxy-5-ethyl-1,3-difluoro-2-methylocta-2,4-diene |
| SMILES | CCC/C(CC)=C(OCC)/C(F)=C(/C)CF |
| InChI | InChI=1S/C13H22F2O/c1-5-8-11(6-2)13(16-7-3)12(15)10(4)9-14/h5-9H2,1-4H3/b12-10+,13-11- |
| InChIKey | BLIDTZFJCDJIFG-FAEGWCMCSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|