C11H17FO — CID 89247374
6-fluoro-3,7-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-chromene (PubChem CID 89247374) has the molecular formula C11H17FO and a molecular weight of 184.25 g/mol. Its IUPAC name is 6-fluoro-3,7-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-chromene.
| Compound Name | 6-fluoro-3,7-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-chromene |
|---|---|
| PubChem CID | 89247374 |
| Molecular Formula | C11H17FO |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 6-fluoro-3,7-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-chromene |
| SMILES | CC1COC2CC(C)C(F)=CC2C1 |
| InChI | InChI=1S/C11H17FO/c1-7-3-9-5-10(12)8(2)4-11(9)13-6-7/h5,7-9,11H,3-4,6H2,1-2H3 |
| InChIKey | HYXVPUHAPWBEMF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |