C14H24F2 — CID 89247413
(2E,4E)-5-ethyl-1,3-difluoro-2,4,7-trimethylnona-2,4-diene (PubChem CID 89247413) has the molecular formula C14H24F2 and a molecular weight of 230.34 g/mol. Its IUPAC name is (2E,4E)-5-ethyl-1,3-difluoro-2,4,7-trimethylnona-2,4-diene.
| Compound Name | (2E,4E)-5-ethyl-1,3-difluoro-2,4,7-trimethylnona-2,4-diene |
|---|---|
| PubChem CID | 89247413 |
| Molecular Formula | C14H24F2 |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (2E,4E)-5-ethyl-1,3-difluoro-2,4,7-trimethylnona-2,4-diene |
| SMILES | CC/C(CC(C)CC)=C(C)\C(F)=C(\C)CF |
| InChI | InChI=1S/C14H24F2/c1-6-10(3)8-13(7-2)12(5)14(16)11(4)9-15/h10H,6-9H2,1-5H3/b13-12+,14-11+ |
| InChIKey | MGRKLVDTIIYFJH-UIGAKZAYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|