C12H19FO — CID 89247476
(6E)-7-fluoro-3,8-dimethyl-10-methylidene-2,3,4,5,8,9-hexahydrooxecine (PubChem CID 89247476) has the molecular formula C12H19FO and a molecular weight of 198.28 g/mol. Its IUPAC name is (6E)-7-fluoro-3,8-dimethyl-10-methylidene-2,3,4,5,8,9-hexahydrooxecine.
| Compound Name | (6E)-7-fluoro-3,8-dimethyl-10-methylidene-2,3,4,5,8,9-hexahydrooxecine |
|---|---|
| PubChem CID | 89247476 |
| Molecular Formula | C12H19FO |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (6E)-7-fluoro-3,8-dimethyl-10-methylidene-2,3,4,5,8,9-hexahydrooxecine |
| SMILES | C=C1CC(C)/C(F)=C\CCC(C)CO1 |
| InChI | InChI=1S/C12H19FO/c1-9-5-4-6-12(13)10(2)7-11(3)14-8-9/h6,9-10H,3-5,7-8H2,1-2H3/b12-6+ |
| InChIKey | ZXFYLTBMZWIXDA-WUXMJOGZSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |