About (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene
(Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene (PubChem CID 89247497) has the molecular formula C14H27F
and a molecular weight of 214.37 g/mol. Its IUPAC name is (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene.
Molecular Properties
| Compound Name | (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene |
| PubChem CID | 89247497 |
| Molecular Formula | C14H27F |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.21 |
| IUPAC Name | (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene |
| SMILES | CCC/C(C)=C(\CC(C)F)CC(C)CC |
| InChI | InChI=1S/C14H27F/c1-6-8-12(4)14(10-13(5)15)9-11(3)7-2/h11,13H,6-10H2,1-5H3/b14-12- |
| InChIKey | CBPAWCSHQFQWSH-OWBHPGMISA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene?
The IUPAC name of (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene (CID 89247497) is (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene.
What is the SMILES notation for (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene?
The canonical SMILES for (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene is CCC/C(C)=C(\CC(C)F)CC(C)CC.
What is the InChIKey of (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene?
The InChIKey is CBPAWCSHQFQWSH-OWBHPGMISA-N. The full InChI is InChI=1S/C14H27F/c1-6-8-12(4)14(10-13(5)15)9-11(3)7-2/h11,13H,6-10H2,1-5H3/b14-12-.
What are the key properties of (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene?
(Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene has a molecular weight of 214.37 g/mol, XLogP of 5.29, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-(2-fluoropropyl)-4,7-dimethylnon-4-ene is sourced from PubChem (CID 89247497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).