C32H32N6O — CID 89247725
2-amino-3-[[3-[cyclopropylidene-(3-imidazol-1-ylpropylamino)methyl]phenyl]methyl]-5,5-diphenylimidazol-4-one (PubChem CID 89247725) has the molecular formula C32H32N6O and a molecular weight of 516.65 g/mol. Its IUPAC name is 2-amino-3-[[3-[cyclopropylidene-(3-imidazol-1-ylpropylamino)methyl]phenyl]methyl]-5,5-diphenylimidazol-4-one.
| Compound Name | 2-amino-3-[[3-[cyclopropylidene-(3-imidazol-1-ylpropylamino)methyl]phenyl]methyl]-5,5-diphenylimidazol-4-one |
|---|---|
| PubChem CID | 89247725 |
| Molecular Formula | C32H32N6O |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 2-amino-3-[[3-[cyclopropylidene-(3-imidazol-1-ylpropylamino)methyl]phenyl]methyl]-5,5-diphenylimidazol-4-one |
| SMILES | NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1cccc(C(NCCCn2ccnc2)=C2CC2)c1 |
| InChI | InChI=1S/C32H32N6O/c33-31-36-32(27-11-3-1-4-12-27,28-13-5-2-6-14-28)30(39)38(31)22-24-9-7-10-26(21-24)29(25-15-16-25)35-17-8-19-37-20-18-34-23-37/h1-7,9-14,18,20-21,23,35H,8,15-17,19,22H2,(H2,33,36) |
| InChIKey | IRIJSOVNULCXSY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|