C14H16O — CID 89247777
[(2Z,4Z)-2-methoxyhepta-2,4,6-trien-3-yl]benzene (PubChem CID 89247777) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is [(2Z,4Z)-2-methoxyhepta-2,4,6-trien-3-yl]benzene.
| Compound Name | [(2Z,4Z)-2-methoxyhepta-2,4,6-trien-3-yl]benzene |
|---|---|
| PubChem CID | 89247777 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | [(2Z,4Z)-2-methoxyhepta-2,4,6-trien-3-yl]benzene |
| SMILES | C=C/C=C\C(=C(/C)OC)c1ccccc1 |
| InChI | InChI=1S/C14H16O/c1-4-5-11-14(12(2)15-3)13-9-7-6-8-10-13/h4-11H,1H2,2-3H3/b11-5-,14-12- |
| InChIKey | CQGJRTWLTNCUSD-FAINUNLVSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|