C20H24BN3OS — CID 89248015
CID 89248015 (PubChem CID 89248015) has the molecular formula C20H24BN3OS and a molecular weight of 365.31 g/mol.
| Compound Name | CID 89248015 |
|---|---|
| PubChem CID | 89248015 |
| Molecular Formula | C20H24BN3OS |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | — |
| SMILES | [B]c1ccc([C@@]2(C)N=C(N)N(C)C(=O)[C@H]2c2ccc(C(C)(C)C)cc2)s1 |
| InChI | InChI=1S/C20H24BN3OS/c1-19(2,3)13-8-6-12(7-9-13)16-17(25)24(5)18(22)23-20(16,4)14-10-11-15(21)26-14/h6-11,16H,1-5H3,(H2,22,23)/t16-,20-/m1/s1 |
| InChIKey | YQHOEEBCENZGIU-OXQOHEQNSA-N |
| XLogP | 2.63 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|