About (3Z)-2-ethenyliminohexa-3,5-dienal
(3Z)-2-ethenyliminohexa-3,5-dienal (PubChem CID 89248761) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is (3Z)-2-ethenyliminohexa-3,5-dienal.
Molecular Properties
| Compound Name | (3Z)-2-ethenyliminohexa-3,5-dienal |
| PubChem CID | 89248761 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | (3Z)-2-ethenyliminohexa-3,5-dienal |
| SMILES | C=C/C=C\C(C=O)=N\C=C |
| InChI | InChI=1S/C8H9NO/c1-3-5-6-8(7-10)9-4-2/h3-7H,1-2H2/b6-5-,9-8- |
| InChIKey | HHYFWRRWAZUEBT-AFJQJTPPSA-N |
| XLogP | 1.51 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-ethenyliminohexa-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-ethenyliminohexa-3,5-dienal?
The IUPAC name of (3Z)-2-ethenyliminohexa-3,5-dienal (CID 89248761) is (3Z)-2-ethenyliminohexa-3,5-dienal.
What is the SMILES notation for (3Z)-2-ethenyliminohexa-3,5-dienal?
The canonical SMILES for (3Z)-2-ethenyliminohexa-3,5-dienal is C=C/C=C\C(C=O)=N\C=C.
What is the InChIKey of (3Z)-2-ethenyliminohexa-3,5-dienal?
The InChIKey is HHYFWRRWAZUEBT-AFJQJTPPSA-N. The full InChI is InChI=1S/C8H9NO/c1-3-5-6-8(7-10)9-4-2/h3-7H,1-2H2/b6-5-,9-8-.
What are the key properties of (3Z)-2-ethenyliminohexa-3,5-dienal?
(3Z)-2-ethenyliminohexa-3,5-dienal has a molecular weight of 135.17 g/mol, XLogP of 1.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-ethenyliminohexa-3,5-dienal is sourced from PubChem (CID 89248761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).