About N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide
N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 89248765) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide |
| PubChem CID | 89248765 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CCC(O)C=C1 |
| InChI | InChI=1S/C8H11NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-4,8,11H,5H2,1H3,(H,9,10) |
| InChIKey | RGBDSIVDHVGPRZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide?
The IUPAC name of N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide (CID 89248765) is N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide.
What is the SMILES notation for N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide?
The canonical SMILES for N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide is CC(=O)NC1=CCC(O)C=C1.
What is the InChIKey of N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide?
The InChIKey is RGBDSIVDHVGPRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-4,8,11H,5H2,1H3,(H,9,10).
What are the key properties of N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide?
N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide has a molecular weight of 153.18 g/mol, XLogP of 0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxycyclohexa-1,5-dien-1-yl)acetamide is sourced from PubChem (CID 89248765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).