About (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide
(Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide (PubChem CID 89248788) has the molecular formula C29H61N3O2S
and a molecular weight of 515.89 g/mol. Its IUPAC name is (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide.
Molecular Properties
| Compound Name | (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide |
| PubChem CID | 89248788 |
| Molecular Formula | C29H61N3O2S |
| Molecular Weight | 515.89 g/mol |
| Exact Mass | 515.45 |
| IUPAC Name | (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide |
| SMILES | CCCCCC/C=C\CCCCCCCCS(=O)(=O)NCCCNCCCNCCC(C)(C)CC |
| InChI | InChI=1S/C29H61N3O2S/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-28-35(33,34)32-26-21-25-30-23-20-24-31-27-22-29(3,4)6-2/h11-12,30-32H,5-10,13-28H2,1-4H3/b12-11- |
| InChIKey | PSMZSZYKPBJLRP-QXMHVHEDSA-N |
| XLogP | 6.95 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.89 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide?
The IUPAC name of (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide (CID 89248788) is (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide.
What is the SMILES notation for (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide?
The canonical SMILES for (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide is CCCCCC/C=C\CCCCCCCCS(=O)(=O)NCCCNCCCNCCC(C)(C)CC.
What is the InChIKey of (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide?
The InChIKey is PSMZSZYKPBJLRP-QXMHVHEDSA-N. The full InChI is InChI=1S/C29H61N3O2S/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-28-35(33,34)32-26-21-25-30-23-20-24-31-27-22-29(3,4)6-2/h11-12,30-32H,5-10,13-28H2,1-4H3/b12-11-.
What are the key properties of (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide?
(Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide has a molecular weight of 515.89 g/mol, XLogP of 6.95, 27 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]hexadec-9-ene-1-sulfonamide is sourced from PubChem (CID 89248788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).