C31H39N3O8 — CID 89248805
[(13R,15S)-13-[(butanoylamino)methyl]-15,22-dihydroxy-21-methoxy-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate (PubChem CID 89248805) has the molecular formula C31H39N3O8 and a molecular weight of 581.67 g/mol. Its IUPAC name is [(13R,15S)-13-[(butanoylamino)methyl]-15,22-dihydroxy-21-methoxy-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate.
| Compound Name | [(13R,15S)-13-[(butanoylamino)methyl]-15,22-dihydroxy-21-methoxy-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate |
|---|---|
| PubChem CID | 89248805 |
| Molecular Formula | C31H39N3O8 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | [(13R,15S)-13-[(butanoylamino)methyl]-15,22-dihydroxy-21-methoxy-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate |
| SMILES | CCCC(=O)NC[C@H]1c2c(c(OC(C)=O)c(C)c3c2OCO3)CC2C3c4c(cc(C)c(OC)c4O)CC([C@H](O)N21)N3C |
| InChI | InChI=1S/C31H39N3O8/c1-7-8-22(36)32-12-21-24-18(28(42-16(4)35)15(3)29-30(24)41-13-40-29)11-19-25-23-17(9-14(2)27(39-6)26(23)37)10-20(33(25)5)31(38)34(19)21/h9,19-21,25,31,37-38H,7-8,10-13H2,1-6H3,(H,32,36)/t19?,20?,21-,25?,31-/m0/s1 |
| InChIKey | SBAFGGCZWPVXEE-YWJDVZGFSA-N |
| XLogP | 2.79 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|