About (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide
(Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide (PubChem CID 89248829) has the molecular formula C23H49N3O2S
and a molecular weight of 431.73 g/mol. Its IUPAC name is (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide.
Molecular Properties
| Compound Name | (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide |
| PubChem CID | 89248829 |
| Molecular Formula | C23H49N3O2S |
| Molecular Weight | 431.73 g/mol |
| Exact Mass | 431.35 |
| IUPAC Name | (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide |
| SMILES | CCCC/C=C\CCCCS(=O)(=O)NCCCNCCCNCCC(C)(C)CC |
| InChI | InChI=1S/C23H49N3O2S/c1-5-7-8-9-10-11-12-13-22-29(27,28)26-20-15-19-24-17-14-18-25-21-16-23(3,4)6-2/h9-10,24-26H,5-8,11-22H2,1-4H3/b10-9- |
| InChIKey | JEEFOFYYPHZFLE-KTKRTIGZSA-N |
| XLogP | 4.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.73 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide?
The IUPAC name of (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide (CID 89248829) is (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide.
What is the SMILES notation for (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide?
The canonical SMILES for (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide is CCCC/C=C\CCCCS(=O)(=O)NCCCNCCCNCCC(C)(C)CC.
What is the InChIKey of (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide?
The InChIKey is JEEFOFYYPHZFLE-KTKRTIGZSA-N. The full InChI is InChI=1S/C23H49N3O2S/c1-5-7-8-9-10-11-12-13-22-29(27,28)26-20-15-19-24-17-14-18-25-21-16-23(3,4)6-2/h9-10,24-26H,5-8,11-22H2,1-4H3/b10-9-.
What are the key properties of (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide?
(Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide has a molecular weight of 431.73 g/mol, XLogP of 4.61, 21 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[3-[3-(3,3-dimethylpentylamino)propylamino]propyl]dec-5-ene-1-sulfonamide is sourced from PubChem (CID 89248829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).