About 2,4-dichloro-1-ethyl-3,5-dimethylbenzene
2,4-dichloro-1-ethyl-3,5-dimethylbenzene (PubChem CID 89248881) has the molecular formula C10H12Cl2
and a molecular weight of 203.11 g/mol. Its IUPAC name is 2,4-dichloro-1-ethyl-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 2,4-dichloro-1-ethyl-3,5-dimethylbenzene |
| PubChem CID | 89248881 |
| Molecular Formula | C10H12Cl2 |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 2,4-dichloro-1-ethyl-3,5-dimethylbenzene |
| SMILES | CCc1cc(C)c(Cl)c(C)c1Cl |
| InChI | InChI=1S/C10H12Cl2/c1-4-8-5-6(2)9(11)7(3)10(8)12/h5H,4H2,1-3H3 |
| InChIKey | WWGAUDVWFHDEOY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,4-dichloro-1-ethyl-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-1-ethyl-3,5-dimethylbenzene?
The IUPAC name of 2,4-dichloro-1-ethyl-3,5-dimethylbenzene (CID 89248881) is 2,4-dichloro-1-ethyl-3,5-dimethylbenzene.
What is the SMILES notation for 2,4-dichloro-1-ethyl-3,5-dimethylbenzene?
The canonical SMILES for 2,4-dichloro-1-ethyl-3,5-dimethylbenzene is CCc1cc(C)c(Cl)c(C)c1Cl.
What is the InChIKey of 2,4-dichloro-1-ethyl-3,5-dimethylbenzene?
The InChIKey is WWGAUDVWFHDEOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2/c1-4-8-5-6(2)9(11)7(3)10(8)12/h5H,4H2,1-3H3.
What are the key properties of 2,4-dichloro-1-ethyl-3,5-dimethylbenzene?
2,4-dichloro-1-ethyl-3,5-dimethylbenzene has a molecular weight of 203.11 g/mol, XLogP of 4.17, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-1-ethyl-3,5-dimethylbenzene is sourced from PubChem (CID 89248881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).