About N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine
N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine (PubChem CID 89248882) has the molecular formula C18H14Cl2N4S
and a molecular weight of 389.31 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine.
Molecular Properties
| Compound Name | N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine |
| PubChem CID | 89248882 |
| Molecular Formula | C18H14Cl2N4S |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine |
| SMILES | Clc1cc(Cl)cc(SNc2cccc3c2CCN3c2ncccn2)c1 |
| InChI | InChI=1S/C18H14Cl2N4S/c19-12-9-13(20)11-14(10-12)25-23-16-3-1-4-17-15(16)5-8-24(17)18-21-6-2-7-22-18/h1-4,6-7,9-11,23H,5,8H2 |
| InChIKey | VORGOWIMASGSJP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine?
The IUPAC name of N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine (CID 89248882) is N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine.
What is the SMILES notation for N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine?
The canonical SMILES for N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine is Clc1cc(Cl)cc(SNc2cccc3c2CCN3c2ncccn2)c1.
What is the InChIKey of N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine?
The InChIKey is VORGOWIMASGSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl2N4S/c19-12-9-13(20)11-14(10-12)25-23-16-3-1-4-17-15(16)5-8-24(17)18-21-6-2-7-22-18/h1-4,6-7,9-11,23H,5,8H2.
What are the key properties of N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine?
N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine has a molecular weight of 389.31 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dichlorophenyl)sulfanyl-1-pyrimidin-2-yl-2,3-dihydroindol-4-amine is sourced from PubChem (CID 89248882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).