About (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid
(3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid (PubChem CID 89248977) has the molecular formula C6H8O3S
and a molecular weight of 160.19 g/mol. Its IUPAC name is (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid |
| PubChem CID | 89248977 |
| Molecular Formula | C6H8O3S |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid |
| SMILES | O=C(O)C1=CCOC[C@H]1S |
| InChI | InChI=1S/C6H8O3S/c7-6(8)4-1-2-9-3-5(4)10/h1,5,10H,2-3H2,(H,7,8)/t5-/m1/s1 |
| InChIKey | YLCNVYBNSKSKIJ-RXMQYKEDSA-N |
| XLogP | 0.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid?
The IUPAC name of (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid (CID 89248977) is (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid.
What is the SMILES notation for (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid?
The canonical SMILES for (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid is O=C(O)C1=CCOC[C@H]1S.
What is the InChIKey of (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid?
The InChIKey is YLCNVYBNSKSKIJ-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H8O3S/c7-6(8)4-1-2-9-3-5(4)10/h1,5,10H,2-3H2,(H,7,8)/t5-/m1/s1.
What are the key properties of (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid?
(3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid has a molecular weight of 160.19 g/mol, XLogP of 0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylic acid is sourced from PubChem (CID 89248977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).