About propan-1-ol;N,2,2-trimethylcyclopentan-1-amine
propan-1-ol;N,2,2-trimethylcyclopentan-1-amine (PubChem CID 89249500) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is propan-1-ol;N,2,2-trimethylcyclopentan-1-amine.
Molecular Properties
| Compound Name | propan-1-ol;N,2,2-trimethylcyclopentan-1-amine |
| PubChem CID | 89249500 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | propan-1-ol;N,2,2-trimethylcyclopentan-1-amine |
| SMILES | CCCO.CNC1CCCC1(C)C |
| InChI | InChI=1S/C8H17N.C3H8O/c1-8(2)6-4-5-7(8)9-3;1-2-3-4/h7,9H,4-6H2,1-3H3;4H,2-3H2,1H3 |
| InChIKey | MMXTZMMTGPSAEV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-1-ol;N,2,2-trimethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-1-ol;N,2,2-trimethylcyclopentan-1-amine?
The IUPAC name of propan-1-ol;N,2,2-trimethylcyclopentan-1-amine (CID 89249500) is propan-1-ol;N,2,2-trimethylcyclopentan-1-amine.
What is the SMILES notation for propan-1-ol;N,2,2-trimethylcyclopentan-1-amine?
The canonical SMILES for propan-1-ol;N,2,2-trimethylcyclopentan-1-amine is CCCO.CNC1CCCC1(C)C.
What is the InChIKey of propan-1-ol;N,2,2-trimethylcyclopentan-1-amine?
The InChIKey is MMXTZMMTGPSAEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C3H8O/c1-8(2)6-4-5-7(8)9-3;1-2-3-4/h7,9H,4-6H2,1-3H3;4H,2-3H2,1H3.
What are the key properties of propan-1-ol;N,2,2-trimethylcyclopentan-1-amine?
propan-1-ol;N,2,2-trimethylcyclopentan-1-amine has a molecular weight of 187.33 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-1-ol;N,2,2-trimethylcyclopentan-1-amine is sourced from PubChem (CID 89249500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).